C24H25BrN4O3 — CID 44564192
3-(dimethylamino)propyl (E)-5-[4-(3-bromoanilino)quinazolin-6-yl]-4-oxopent-2-enoate (PubChem CID 44564192) has the molecular formula C24H25BrN4O3 and a molecular weight of 497.39 g/mol. Its IUPAC name is 3-(dimethylamino)propyl (E)-5-[4-(3-bromoanilino)quinazolin-6-yl]-4-oxopent-2-enoate.
| Compound Name | 3-(dimethylamino)propyl (E)-5-[4-(3-bromoanilino)quinazolin-6-yl]-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 44564192 |
| Molecular Formula | C24H25BrN4O3 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 3-(dimethylamino)propyl (E)-5-[4-(3-bromoanilino)quinazolin-6-yl]-4-oxopent-2-enoate |
| SMILES | CN(C)CCCOC(=O)/C=C/C(=O)Cc1ccc2ncnc(Nc3cccc(Br)c3)c2c1 |
| InChI | InChI=1S/C24H25BrN4O3/c1-29(2)11-4-12-32-23(31)10-8-20(30)13-17-7-9-22-21(14-17)24(27-16-26-22)28-19-6-3-5-18(25)15-19/h3,5-10,14-16H,4,11-13H2,1-2H3,(H,26,27,28)/b10-8+ |
| InChIKey | GAKXNKLFSIXQKN-CSKARUKUSA-N |
| XLogP | 4.30 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|