C20H21BrN6O — CID 5329082
N-[4-(3-bromoanilino)pyrido[3,4-d]pyrimidin-6-yl]-N-[2-(dimethylamino)ethyl]prop-2-enamide (PubChem CID 5329082) has the molecular formula C20H21BrN6O and a molecular weight of 441.33 g/mol. Its IUPAC name is N-[4-(3-bromoanilino)pyrido[3,4-d]pyrimidin-6-yl]-N-[2-(dimethylamino)ethyl]prop-2-enamide.
| Compound Name | N-[4-(3-bromoanilino)pyrido[3,4-d]pyrimidin-6-yl]-N-[2-(dimethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 5329082 |
| Molecular Formula | C20H21BrN6O |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-[4-(3-bromoanilino)pyrido[3,4-d]pyrimidin-6-yl]-N-[2-(dimethylamino)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCN(C)C)c1cc2c(Nc3cccc(Br)c3)ncnc2cn1 |
| InChI | InChI=1S/C20H21BrN6O/c1-4-19(28)27(9-8-26(2)3)18-11-16-17(12-22-18)23-13-24-20(16)25-15-7-5-6-14(21)10-15/h4-7,10-13H,1,8-9H2,2-3H3,(H,23,24,25) |
| InChIKey | JXKNVASLVHCEQV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|