C16H18BrN3O2 — CID 169427940
N-(3-bromophenyl)-6,7-dimethylquinazolin-4-amine;dihydrate (PubChem CID 169427940) has the molecular formula C16H18BrN3O2 and a molecular weight of 364.24 g/mol. Its IUPAC name is N-(3-bromophenyl)-6,7-dimethylquinazolin-4-amine;dihydrate.
| Compound Name | N-(3-bromophenyl)-6,7-dimethylquinazolin-4-amine;dihydrate |
|---|---|
| PubChem CID | 169427940 |
| Molecular Formula | C16H18BrN3O2 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | N-(3-bromophenyl)-6,7-dimethylquinazolin-4-amine;dihydrate |
| SMILES | Cc1cc2ncnc(Nc3cccc(Br)c3)c2cc1C.O.O |
| InChI | InChI=1S/C16H14BrN3.2H2O/c1-10-6-14-15(7-11(10)2)18-9-19-16(14)20-13-5-3-4-12(17)8-13;;/h3-9H,1-2H3,(H,18,19,20);2*1H2 |
| InChIKey | VHXXPGLSQMBZHN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |