C16H15N3O — CID 18685574
4-[(6,7-dimethylquinazolin-4-yl)amino]phenol (PubChem CID 18685574) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 4-[(6,7-dimethylquinazolin-4-yl)amino]phenol.
| Compound Name | 4-[(6,7-dimethylquinazolin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 18685574 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 4-[(6,7-dimethylquinazolin-4-yl)amino]phenol |
| SMILES | Cc1cc2ncnc(Nc3ccc(O)cc3)c2cc1C |
| InChI | InChI=1S/C16H15N3O/c1-10-7-14-15(8-11(10)2)17-9-18-16(14)19-12-3-5-13(20)6-4-12/h3-9,20H,1-2H3,(H,17,18,19) |
| InChIKey | HGLYVLUNPBACGI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|