About 4-anilinoquinazolin-6-ol;ethane
4-anilinoquinazolin-6-ol;ethane (PubChem CID 91520479) has the molecular formula C18H23N3O
and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-anilinoquinazolin-6-ol;ethane.
Molecular Properties
| Compound Name | 4-anilinoquinazolin-6-ol;ethane |
| PubChem CID | 91520479 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 4-anilinoquinazolin-6-ol;ethane |
| SMILES | CC.CC.Oc1ccc2ncnc(Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C14H11N3O.2C2H6/c18-11-6-7-13-12(8-11)14(16-9-15-13)17-10-4-2-1-3-5-10;2*1-2/h1-9,18H,(H,15,16,17);2*1-2H3 |
| InChIKey | ARNBHWFAPIBDJI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-anilinoquinazolin-6-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilinoquinazolin-6-ol;ethane?
The IUPAC name of 4-anilinoquinazolin-6-ol;ethane (CID 91520479) is 4-anilinoquinazolin-6-ol;ethane.
What is the SMILES notation for 4-anilinoquinazolin-6-ol;ethane?
The canonical SMILES for 4-anilinoquinazolin-6-ol;ethane is CC.CC.Oc1ccc2ncnc(Nc3ccccc3)c2c1.
What is the InChIKey of 4-anilinoquinazolin-6-ol;ethane?
The InChIKey is ARNBHWFAPIBDJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O.2C2H6/c18-11-6-7-13-12(8-11)14(16-9-15-13)17-10-4-2-1-3-5-10;2*1-2/h1-9,18H,(H,15,16,17);2*1-2H3.
What are the key properties of 4-anilinoquinazolin-6-ol;ethane?
4-anilinoquinazolin-6-ol;ethane has a molecular weight of 297.40 g/mol, XLogP of 5.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilinoquinazolin-6-ol;ethane is sourced from PubChem (CID 91520479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).