C15H14N4O2S — CID 42641380
3-[[6-(methylsulfonimidoyl)quinazolin-4-yl]amino]phenol (PubChem CID 42641380) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 3-[[6-(methylsulfonimidoyl)quinazolin-4-yl]amino]phenol.
| Compound Name | 3-[[6-(methylsulfonimidoyl)quinazolin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 42641380 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3-[[6-(methylsulfonimidoyl)quinazolin-4-yl]amino]phenol |
| SMILES | [H]N=S(C)(=O)c1ccc2ncnc(Nc3cccc(O)c3)c2c1 |
| InChI | InChI=1S/C15H14N4O2S/c1-22(16,21)12-5-6-14-13(8-12)15(18-9-17-14)19-10-3-2-4-11(20)7-10/h2-9,16,20H,1H3,(H,17,18,19) |
| InChIKey | DOAVIBHLFHDIPN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |