C16H12FN3O2 — CID 110434578
methyl 3-[(6-fluoroquinazolin-4-yl)amino]benzoate (PubChem CID 110434578) has the molecular formula C16H12FN3O2 and a molecular weight of 297.29 g/mol. Its IUPAC name is methyl 3-[(6-fluoroquinazolin-4-yl)amino]benzoate.
| Compound Name | methyl 3-[(6-fluoroquinazolin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 110434578 |
| Molecular Formula | C16H12FN3O2 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | methyl 3-[(6-fluoroquinazolin-4-yl)amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2ncnc3ccc(F)cc23)c1 |
| InChI | InChI=1S/C16H12FN3O2/c1-22-16(21)10-3-2-4-12(7-10)20-15-13-8-11(17)5-6-14(13)18-9-19-15/h2-9H,1H3,(H,18,19,20) |
| InChIKey | VFEHRAFQYHDLMX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |