C24H19FIN3O3 — CID 89367137
methyl 4-[4-[(3-fluorophenyl)methoxy]-3-(iodomethyl)anilino]quinazoline-6-carboxylate (PubChem CID 89367137) has the molecular formula C24H19FIN3O3 and a molecular weight of 543.34 g/mol. Its IUPAC name is methyl 4-[4-[(3-fluorophenyl)methoxy]-3-(iodomethyl)anilino]quinazoline-6-carboxylate.
| Compound Name | methyl 4-[4-[(3-fluorophenyl)methoxy]-3-(iodomethyl)anilino]quinazoline-6-carboxylate |
|---|---|
| PubChem CID | 89367137 |
| Molecular Formula | C24H19FIN3O3 |
| Molecular Weight | 543.34 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | methyl 4-[4-[(3-fluorophenyl)methoxy]-3-(iodomethyl)anilino]quinazoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(CI)c3)c2c1 |
| InChI | InChI=1S/C24H19FIN3O3/c1-31-24(30)16-5-7-21-20(11-16)23(28-14-27-21)29-19-6-8-22(17(10-19)12-26)32-13-15-3-2-4-18(25)9-15/h2-11,14H,12-13H2,1H3,(H,27,28,29) |
| InChIKey | NMGPOXWLXWJHAR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|