C24H19FIN3O2 — CID 89367136
1-[4-[4-[(3-fluorophenyl)methoxy]-3-(iodomethyl)anilino]quinazolin-6-yl]ethanone (PubChem CID 89367136) has the molecular formula C24H19FIN3O2 and a molecular weight of 527.34 g/mol. Its IUPAC name is 1-[4-[4-[(3-fluorophenyl)methoxy]-3-(iodomethyl)anilino]quinazolin-6-yl]ethanone.
| Compound Name | 1-[4-[4-[(3-fluorophenyl)methoxy]-3-(iodomethyl)anilino]quinazolin-6-yl]ethanone |
|---|---|
| PubChem CID | 89367136 |
| Molecular Formula | C24H19FIN3O2 |
| Molecular Weight | 527.34 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | 1-[4-[4-[(3-fluorophenyl)methoxy]-3-(iodomethyl)anilino]quinazolin-6-yl]ethanone |
| SMILES | CC(=O)c1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(CI)c3)c2c1 |
| InChI | InChI=1S/C24H19FIN3O2/c1-15(30)17-5-7-22-21(11-17)24(28-14-27-22)29-20-6-8-23(18(10-20)12-26)31-13-16-3-2-4-19(25)9-16/h2-11,14H,12-13H2,1H3,(H,27,28,29) |
| InChIKey | YOVIAYVEFPEHMK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.34 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|