C31H35IN6O4 — CID 89367134
tert-butyl N-[2-[(E)-1-[4-[3-(iodomethyl)-4-(pyridin-3-ylmethoxy)anilino]quinazolin-6-yl]ethylideneamino]oxyethyl]-N-methylcarbamate (PubChem CID 89367134) has the molecular formula C31H35IN6O4 and a molecular weight of 682.56 g/mol. Its IUPAC name is tert-butyl N-[2-[(E)-1-[4-[3-(iodomethyl)-4-(pyridin-3-ylmethoxy)anilino]quinazolin-6-yl]ethylideneamino]oxyethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[(E)-1-[4-[3-(iodomethyl)-4-(pyridin-3-ylmethoxy)anilino]quinazolin-6-yl]ethylideneamino]oxyethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 89367134 |
| Molecular Formula | C31H35IN6O4 |
| Molecular Weight | 682.56 g/mol |
| Exact Mass | 682.18 |
| IUPAC Name | tert-butyl N-[2-[(E)-1-[4-[3-(iodomethyl)-4-(pyridin-3-ylmethoxy)anilino]quinazolin-6-yl]ethylideneamino]oxyethyl]-N-methylcarbamate |
| SMILES | C/C(=N\OCCN(C)C(=O)OC(C)(C)C)c1ccc2ncnc(Nc3ccc(OCc4cccnc4)c(CI)c3)c2c1 |
| InChI | InChI=1S/C31H35IN6O4/c1-21(37-41-14-13-38(5)30(39)42-31(2,3)4)23-8-10-27-26(16-23)29(35-20-34-27)36-25-9-11-28(24(15-25)17-32)40-19-22-7-6-12-33-18-22/h6-12,15-16,18,20H,13-14,17,19H2,1-5H3,(H,34,35,36)/b37-21+ |
| InChIKey | KCKOTRUHSNIAKW-FDALDRLYSA-N |
| XLogP | 6.89 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.56 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|