C23H19FN4O — CID 142929583
N-[3-[(E)-N-[(4-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]quinazolin-4-amine (PubChem CID 142929583) has the molecular formula C23H19FN4O and a molecular weight of 386.43 g/mol. Its IUPAC name is N-[3-[(E)-N-[(4-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]quinazolin-4-amine.
| Compound Name | N-[3-[(E)-N-[(4-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 142929583 |
| Molecular Formula | C23H19FN4O |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-[3-[(E)-N-[(4-fluorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]quinazolin-4-amine |
| SMILES | C/C(=N\OCc1ccc(F)cc1)c1cccc(Nc2ncnc3ccccc23)c1 |
| InChI | InChI=1S/C23H19FN4O/c1-16(28-29-14-17-9-11-19(24)12-10-17)18-5-4-6-20(13-18)27-23-21-7-2-3-8-22(21)25-15-26-23/h2-13,15H,14H2,1H3,(H,25,26,27)/b28-16+ |
| InChIKey | UMYNJKTWUKFZIE-LQKURTRISA-N |
| XLogP | 5.45 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|