C24H19N3O3 — CID 18535943
2-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]prop-2-enoic acid (PubChem CID 18535943) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]prop-2-enoic acid.
| Compound Name | 2-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 18535943 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccc2ncnc(Nc3ccc(OCc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C24H19N3O3/c1-16(24(28)29)18-7-12-22-21(13-18)23(26-15-25-22)27-19-8-10-20(11-9-19)30-14-17-5-3-2-4-6-17/h2-13,15H,1,14H2,(H,28,29)(H,25,26,27) |
| InChIKey | MCAOKZSCSYHQRJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|