C37H33N5O3 — CID 18535778
4-phenylmethoxyaniline;N-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]prop-2-enamide (PubChem CID 18535778) has the molecular formula C37H33N5O3 and a molecular weight of 595.70 g/mol. Its IUPAC name is 4-phenylmethoxyaniline;N-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]prop-2-enamide.
| Compound Name | 4-phenylmethoxyaniline;N-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 18535778 |
| Molecular Formula | C37H33N5O3 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 4-phenylmethoxyaniline;N-[4-(4-phenylmethoxyanilino)quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2ncnc(Nc3ccc(OCc4ccccc4)cc3)c2c1.Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N4O2.C13H13NO/c1-2-23(29)27-19-10-13-22-21(14-19)24(26-16-25-22)28-18-8-11-20(12-9-18)30-15-17-6-4-3-5-7-17;14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h2-14,16H,1,15H2,(H,27,29)(H,25,26,28);1-9H,10,14H2 |
| InChIKey | UUTGGZJWHCVVSN-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|