C23H18F3N3O2 — CID 56981677
N-(4-phenylmethoxyphenyl)-6-(2,2,2-trifluoroethoxy)quinazolin-4-amine (PubChem CID 56981677) has the molecular formula C23H18F3N3O2 and a molecular weight of 425.41 g/mol. Its IUPAC name is N-(4-phenylmethoxyphenyl)-6-(2,2,2-trifluoroethoxy)quinazolin-4-amine.
| Compound Name | N-(4-phenylmethoxyphenyl)-6-(2,2,2-trifluoroethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 56981677 |
| Molecular Formula | C23H18F3N3O2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-(4-phenylmethoxyphenyl)-6-(2,2,2-trifluoroethoxy)quinazolin-4-amine |
| SMILES | FC(F)(F)COc1ccc2ncnc(Nc3ccc(OCc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C23H18F3N3O2/c24-23(25,26)14-31-19-10-11-21-20(12-19)22(28-15-27-21)29-17-6-8-18(9-7-17)30-13-16-4-2-1-3-5-16/h1-12,15H,13-14H2,(H,27,28,29) |
| InChIKey | KNUIMUUOIILGHP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |