C21H15Br2N3O — CID 23966453
6,8-dibromo-N-(4-phenylmethoxyphenyl)quinazolin-4-amine (PubChem CID 23966453) has the molecular formula C21H15Br2N3O and a molecular weight of 485.18 g/mol. Its IUPAC name is 6,8-dibromo-N-(4-phenylmethoxyphenyl)quinazolin-4-amine.
| Compound Name | 6,8-dibromo-N-(4-phenylmethoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 23966453 |
| Molecular Formula | C21H15Br2N3O |
| Molecular Weight | 485.18 g/mol |
| Exact Mass | 482.96 |
| IUPAC Name | 6,8-dibromo-N-(4-phenylmethoxyphenyl)quinazolin-4-amine |
| SMILES | Brc1cc(Br)c2ncnc(Nc3ccc(OCc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C21H15Br2N3O/c22-15-10-18-20(19(23)11-15)24-13-25-21(18)26-16-6-8-17(9-7-16)27-12-14-4-2-1-3-5-14/h1-11,13H,12H2,(H,24,25,26) |
| InChIKey | BGPXVCHXPLFYHG-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.18 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |