C14H8Br2ClN3 — CID 23941005
6,8-dibromo-N-(3-chlorophenyl)quinazolin-4-amine (PubChem CID 23941005) has the molecular formula C14H8Br2ClN3 and a molecular weight of 413.50 g/mol. Its IUPAC name is 6,8-dibromo-N-(3-chlorophenyl)quinazolin-4-amine.
| Compound Name | 6,8-dibromo-N-(3-chlorophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 23941005 |
| Molecular Formula | C14H8Br2ClN3 |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 410.88 |
| IUPAC Name | 6,8-dibromo-N-(3-chlorophenyl)quinazolin-4-amine |
| SMILES | Clc1cccc(Nc2ncnc3c(Br)cc(Br)cc23)c1 |
| InChI | InChI=1S/C14H8Br2ClN3/c15-8-4-11-13(12(16)5-8)18-7-19-14(11)20-10-3-1-2-9(17)6-10/h1-7H,(H,18,19,20) |
| InChIKey | LAWBYWLAUNDAGI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |