C17H16ClN5 — CID 19148233
4-N-(3-chlorophenyl)-6-N-(3-methylphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19148233) has the molecular formula C17H16ClN5 and a molecular weight of 325.80 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-6-N-(3-methylphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(3-chlorophenyl)-6-N-(3-methylphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19148233 |
| Molecular Formula | C17H16ClN5 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-N-(3-chlorophenyl)-6-N-(3-methylphenyl)pyrimidine-4,5,6-triamine |
| SMILES | Cc1cccc(Nc2ncnc(Nc3cccc(Cl)c3)c2N)c1 |
| InChI | InChI=1S/C17H16ClN5/c1-11-4-2-6-13(8-11)22-16-15(19)17(21-10-20-16)23-14-7-3-5-12(18)9-14/h2-10H,19H2,1H3,(H2,20,21,22,23) |
| InChIKey | QWDSUKZREDBTOO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |