C13H13ClN4 — CID 142993577
acetylene;6-chloro-4-N-(3-methylphenyl)pyrimidine-4,5-diamine (PubChem CID 142993577) has the molecular formula C13H13ClN4 and a molecular weight of 260.73 g/mol. Its IUPAC name is acetylene;6-chloro-4-N-(3-methylphenyl)pyrimidine-4,5-diamine.
| Compound Name | acetylene;6-chloro-4-N-(3-methylphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 142993577 |
| Molecular Formula | C13H13ClN4 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | acetylene;6-chloro-4-N-(3-methylphenyl)pyrimidine-4,5-diamine |
| SMILES | C#C.Cc1cccc(Nc2ncnc(Cl)c2N)c1 |
| InChI | InChI=1S/C11H11ClN4.C2H2/c1-7-3-2-4-8(5-7)16-11-9(13)10(12)14-6-15-11;1-2/h2-6H,13H2,1H3,(H,14,15,16);1-2H |
| InChIKey | SPPSMSSPMGRZIW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|