C12H10ClN3O — CID 66366113
4-chloro-6-(3-methylanilino)pyrimidine-5-carbaldehyde (PubChem CID 66366113) has the molecular formula C12H10ClN3O and a molecular weight of 247.69 g/mol. Its IUPAC name is 4-chloro-6-(3-methylanilino)pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-6-(3-methylanilino)pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 66366113 |
| Molecular Formula | C12H10ClN3O |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 4-chloro-6-(3-methylanilino)pyrimidine-5-carbaldehyde |
| SMILES | Cc1cccc(Nc2ncnc(Cl)c2C=O)c1 |
| InChI | InChI=1S/C12H10ClN3O/c1-8-3-2-4-9(5-8)16-12-10(6-17)11(13)14-7-15-12/h2-7H,1H3,(H,14,15,16) |
| InChIKey | CTSWDGXYTFJRBQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|