C12H7ClF3N3O2 — CID 66366312
4-chloro-6-[3-(trifluoromethoxy)anilino]pyrimidine-5-carbaldehyde (PubChem CID 66366312) has the molecular formula C12H7ClF3N3O2 and a molecular weight of 317.65 g/mol. Its IUPAC name is 4-chloro-6-[3-(trifluoromethoxy)anilino]pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-6-[3-(trifluoromethoxy)anilino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 66366312 |
| Molecular Formula | C12H7ClF3N3O2 |
| Molecular Weight | 317.65 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 4-chloro-6-[3-(trifluoromethoxy)anilino]pyrimidine-5-carbaldehyde |
| SMILES | O=Cc1c(Cl)ncnc1Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H7ClF3N3O2/c13-10-9(5-20)11(18-6-17-10)19-7-2-1-3-8(4-7)21-12(14,15)16/h1-6H,(H,17,18,19) |
| InChIKey | GVHJRYYDENWTPK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|