C12H9ClF3N3O — CID 63736450
6-chloro-5-methyl-N-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine (PubChem CID 63736450) has the molecular formula C12H9ClF3N3O and a molecular weight of 303.67 g/mol. Its IUPAC name is 6-chloro-5-methyl-N-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-N-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63736450 |
| Molecular Formula | C12H9ClF3N3O |
| Molecular Weight | 303.67 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 6-chloro-5-methyl-N-[3-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
| SMILES | Cc1c(Cl)ncnc1Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H9ClF3N3O/c1-7-10(13)17-6-18-11(7)19-8-3-2-4-9(5-8)20-12(14,15)16/h2-6H,1H3,(H,17,18,19) |
| InChIKey | AMBWZVISRAVFBN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |