C12H10F3N3O — CID 29067513
2-N-[3-(trifluoromethoxy)phenyl]pyridine-2,3-diamine (PubChem CID 29067513) has the molecular formula C12H10F3N3O and a molecular weight of 269.23 g/mol. Its IUPAC name is 2-N-[3-(trifluoromethoxy)phenyl]pyridine-2,3-diamine.
| Compound Name | 2-N-[3-(trifluoromethoxy)phenyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 29067513 |
| Molecular Formula | C12H10F3N3O |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-N-[3-(trifluoromethoxy)phenyl]pyridine-2,3-diamine |
| SMILES | Nc1cccnc1Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F3N3O/c13-12(14,15)19-9-4-1-3-8(7-9)18-11-10(16)5-2-6-17-11/h1-7H,16H2,(H,17,18) |
| InChIKey | XIGOCBPTGFNSRT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |