C20H14F6N2O2 — CID 19351987
1-N,2-N-bis[3-(trifluoromethoxy)phenyl]benzene-1,2-diamine (PubChem CID 19351987) has the molecular formula C20H14F6N2O2 and a molecular weight of 428.33 g/mol. Its IUPAC name is 1-N,2-N-bis[3-(trifluoromethoxy)phenyl]benzene-1,2-diamine.
| Compound Name | 1-N,2-N-bis[3-(trifluoromethoxy)phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 19351987 |
| Molecular Formula | C20H14F6N2O2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 1-N,2-N-bis[3-(trifluoromethoxy)phenyl]benzene-1,2-diamine |
| SMILES | FC(F)(F)Oc1cccc(Nc2ccccc2Nc2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H14F6N2O2/c21-19(22,23)29-15-7-3-5-13(11-15)27-17-9-1-2-10-18(17)28-14-6-4-8-16(12-14)30-20(24,25)26/h1-12,27-28H |
| InChIKey | FXOMKGNJPGNILB-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |