C14H16ClN3 — CID 63734214
6-chloro-5-methyl-N-(3-propan-2-ylphenyl)pyrimidin-4-amine (PubChem CID 63734214) has the molecular formula C14H16ClN3 and a molecular weight of 261.76 g/mol. Its IUPAC name is 6-chloro-5-methyl-N-(3-propan-2-ylphenyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-N-(3-propan-2-ylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 63734214 |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6-chloro-5-methyl-N-(3-propan-2-ylphenyl)pyrimidin-4-amine |
| SMILES | Cc1c(Cl)ncnc1Nc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C14H16ClN3/c1-9(2)11-5-4-6-12(7-11)18-14-10(3)13(15)16-8-17-14/h4-9H,1-3H3,(H,16,17,18) |
| InChIKey | AITZZASBLJHEKC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |