C13H15N5O2 — CID 80759446
5-nitro-4-N-(3-propan-2-ylphenyl)pyrimidine-4,6-diamine (PubChem CID 80759446) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 5-nitro-4-N-(3-propan-2-ylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 5-nitro-4-N-(3-propan-2-ylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80759446 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 5-nitro-4-N-(3-propan-2-ylphenyl)pyrimidine-4,6-diamine |
| SMILES | CC(C)c1cccc(Nc2ncnc(N)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15N5O2/c1-8(2)9-4-3-5-10(6-9)17-13-11(18(19)20)12(14)15-7-16-13/h3-8H,1-2H3,(H3,14,15,16,17) |
| InChIKey | VPJRDKCXQKVINL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|