C10H6F3N3O3 — CID 143766470
5-[3-(trifluoromethoxy)anilino]-1,3,4-oxadiazole-2-carbaldehyde (PubChem CID 143766470) has the molecular formula C10H6F3N3O3 and a molecular weight of 273.17 g/mol. Its IUPAC name is 5-[3-(trifluoromethoxy)anilino]-1,3,4-oxadiazole-2-carbaldehyde.
| Compound Name | 5-[3-(trifluoromethoxy)anilino]-1,3,4-oxadiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 143766470 |
| Molecular Formula | C10H6F3N3O3 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 5-[3-(trifluoromethoxy)anilino]-1,3,4-oxadiazole-2-carbaldehyde |
| SMILES | O=Cc1nnc(Nc2cccc(OC(F)(F)F)c2)o1 |
| InChI | InChI=1S/C10H6F3N3O3/c11-10(12,13)19-7-3-1-2-6(4-7)14-9-16-15-8(5-17)18-9/h1-5H,(H,14,16) |
| InChIKey | WOFWNHXQJLEEND-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|