About formyl chloride;3-(trifluoromethoxy)benzaldehyde
formyl chloride;3-(trifluoromethoxy)benzaldehyde (PubChem CID 174520799) has the molecular formula C9H6ClF3O3
and a molecular weight of 254.59 g/mol. Its IUPAC name is formyl chloride;3-(trifluoromethoxy)benzaldehyde.
Molecular Properties
| Compound Name | formyl chloride;3-(trifluoromethoxy)benzaldehyde |
| PubChem CID | 174520799 |
| Molecular Formula | C9H6ClF3O3 |
| Molecular Weight | 254.59 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | formyl chloride;3-(trifluoromethoxy)benzaldehyde |
| SMILES | O=CCl.O=Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C8H5F3O2.CHClO/c9-8(10,11)13-7-3-1-2-6(4-7)5-12;2-1-3/h1-5H;1H |
| InChIKey | DPEUZSNALPTLBK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formyl chloride;3-(trifluoromethoxy)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl chloride;3-(trifluoromethoxy)benzaldehyde?
The IUPAC name of formyl chloride;3-(trifluoromethoxy)benzaldehyde (CID 174520799) is formyl chloride;3-(trifluoromethoxy)benzaldehyde.
What is the SMILES notation for formyl chloride;3-(trifluoromethoxy)benzaldehyde?
The canonical SMILES for formyl chloride;3-(trifluoromethoxy)benzaldehyde is O=CCl.O=Cc1cccc(OC(F)(F)F)c1.
What is the InChIKey of formyl chloride;3-(trifluoromethoxy)benzaldehyde?
The InChIKey is DPEUZSNALPTLBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3O2.CHClO/c9-8(10,11)13-7-3-1-2-6(4-7)5-12;2-1-3/h1-5H;1H.
What are the key properties of formyl chloride;3-(trifluoromethoxy)benzaldehyde?
formyl chloride;3-(trifluoromethoxy)benzaldehyde has a molecular weight of 254.59 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formyl chloride;3-(trifluoromethoxy)benzaldehyde is sourced from PubChem (CID 174520799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).