C20H12F6O4 — CID 154161092
1,3-bis[3-(trifluoromethoxy)phenoxy]benzene (PubChem CID 154161092) has the molecular formula C20H12F6O4 and a molecular weight of 430.30 g/mol. Its IUPAC name is 1,3-bis[3-(trifluoromethoxy)phenoxy]benzene.
| Compound Name | 1,3-bis[3-(trifluoromethoxy)phenoxy]benzene |
|---|---|
| PubChem CID | 154161092 |
| Molecular Formula | C20H12F6O4 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 1,3-bis[3-(trifluoromethoxy)phenoxy]benzene |
| SMILES | FC(F)(F)Oc1cccc(Oc2cccc(Oc3cccc(OC(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C20H12F6O4/c21-19(22,23)29-17-8-2-6-15(11-17)27-13-4-1-5-14(10-13)28-16-7-3-9-18(12-16)30-20(24,25)26/h1-12H |
| InChIKey | YSPJPVNDXAQJRN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |