About trifluoromethoxybenzene
trifluoromethoxybenzene (PubChem CID 157402708) has the molecular formula C14H10F6O2
and a molecular weight of 324.22 g/mol. Its IUPAC name is trifluoromethoxybenzene.
Molecular Properties
| Compound Name | trifluoromethoxybenzene |
| PubChem CID | 157402708 |
| Molecular Formula | C14H10F6O2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | trifluoromethoxybenzene |
| SMILES | FC(F)(F)Oc1ccccc1.FC(F)(F)Oc1ccccc1 |
| InChI | InChI=1S/2C7H5F3O/c2*8-7(9,10)11-6-4-2-1-3-5-6/h2*1-5H |
| InChIKey | BNIWYPJDODFJTL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trifluoromethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethoxybenzene?
The IUPAC name of trifluoromethoxybenzene (CID 157402708) is trifluoromethoxybenzene.
What is the SMILES notation for trifluoromethoxybenzene?
The canonical SMILES for trifluoromethoxybenzene is FC(F)(F)Oc1ccccc1.FC(F)(F)Oc1ccccc1.
What is the InChIKey of trifluoromethoxybenzene?
The InChIKey is BNIWYPJDODFJTL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H5F3O/c2*8-7(9,10)11-6-4-2-1-3-5-6/h2*1-5H.
What are the key properties of trifluoromethoxybenzene?
trifluoromethoxybenzene has a molecular weight of 324.22 g/mol, XLogP of 5.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethoxybenzene is sourced from PubChem (CID 157402708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).