About sulfuryl diisocyanide;trifluoromethoxybenzene
sulfuryl diisocyanide;trifluoromethoxybenzene (PubChem CID 162183940) has the molecular formula C9H5F3N2O3S
and a molecular weight of 278.21 g/mol. Its IUPAC name is sulfuryl diisocyanide;trifluoromethoxybenzene.
Molecular Properties
| Compound Name | sulfuryl diisocyanide;trifluoromethoxybenzene |
| PubChem CID | 162183940 |
| Molecular Formula | C9H5F3N2O3S |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | sulfuryl diisocyanide;trifluoromethoxybenzene |
| SMILES | FC(F)(F)Oc1ccccc1.[C-]#[N+]S(=O)(=O)[N+]#[C-] |
| InChI | InChI=1S/C7H5F3O.C2N2O2S/c8-7(9,10)11-6-4-2-1-3-5-6;1-3-7(5,6)4-2/h1-5H; |
| InChIKey | ZPKIPTZIYMTVNT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sulfuryl diisocyanide;trifluoromethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuryl diisocyanide;trifluoromethoxybenzene?
The IUPAC name of sulfuryl diisocyanide;trifluoromethoxybenzene (CID 162183940) is sulfuryl diisocyanide;trifluoromethoxybenzene.
What is the SMILES notation for sulfuryl diisocyanide;trifluoromethoxybenzene?
The canonical SMILES for sulfuryl diisocyanide;trifluoromethoxybenzene is FC(F)(F)Oc1ccccc1.[C-]#[N+]S(=O)(=O)[N+]#[C-].
What is the InChIKey of sulfuryl diisocyanide;trifluoromethoxybenzene?
The InChIKey is ZPKIPTZIYMTVNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3O.C2N2O2S/c8-7(9,10)11-6-4-2-1-3-5-6;1-3-7(5,6)4-2/h1-5H;.
What are the key properties of sulfuryl diisocyanide;trifluoromethoxybenzene?
sulfuryl diisocyanide;trifluoromethoxybenzene has a molecular weight of 278.21 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuryl diisocyanide;trifluoromethoxybenzene is sourced from PubChem (CID 162183940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).