C10H6F8O5S — CID 59850749
1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-phenoxyethoxy)ethanesulfonic acid (PubChem CID 59850749) has the molecular formula C10H6F8O5S and a molecular weight of 390.20 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-phenoxyethoxy)ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-phenoxyethoxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 59850749 |
| Molecular Formula | C10H6F8O5S |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-phenoxyethoxy)ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)Oc1ccccc1 |
| InChI | InChI=1S/C10H6F8O5S/c11-7(12,22-6-4-2-1-3-5-6)8(13,14)23-9(15,16)10(17,18)24(19,20)21/h1-5H,(H,19,20,21) |
| InChIKey | WGRBCXKSUWUJRJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|