C33H28F8O10S2 — CID 59724355
2-[4-[bis(4-hydroxy-3,5-dimethylphenyl)-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]methyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 59724355) has the molecular formula C33H28F8O10S2 and a molecular weight of 800.69 g/mol. Its IUPAC name is 2-[4-[bis(4-hydroxy-3,5-dimethylphenyl)-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]methyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-[4-[bis(4-hydroxy-3,5-dimethylphenyl)-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]methyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 59724355 |
| Molecular Formula | C33H28F8O10S2 |
| Molecular Weight | 800.69 g/mol |
| Exact Mass | 800.10 |
| IUPAC Name | 2-[4-[bis(4-hydroxy-3,5-dimethylphenyl)-[4-(1,1,2,2-tetrafluoro-2-sulfoethoxy)phenyl]methyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | Cc1cc(C(c2ccc(OC(F)(F)C(F)(F)S(=O)(=O)O)cc2)(c2ccc(OC(F)(F)C(F)(F)S(=O)(=O)O)cc2)c2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C33H28F8O10S2/c1-17-13-23(14-18(2)27(17)42)29(24-15-19(3)28(43)20(4)16-24,21-5-9-25(10-6-21)50-30(34,35)32(38,39)52(44,45)46)22-7-11-26(12-8-22)51-31(36,37)33(40,41)53(47,48)49/h5-16,42-43H,1-4H3,(H,44,45,46)(H,47,48,49) |
| InChIKey | KQNINAULZVXLGS-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.69 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|