C16H22F4O4S — CID 140904177
2-(2,5-ditert-butylphenoxy)-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 140904177) has the molecular formula C16H22F4O4S and a molecular weight of 386.41 g/mol. Its IUPAC name is 2-(2,5-ditert-butylphenoxy)-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-(2,5-ditert-butylphenoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 140904177 |
| Molecular Formula | C16H22F4O4S |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-(2,5-ditert-butylphenoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(OC(F)(F)C(F)(F)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C16H22F4O4S/c1-13(2,3)10-7-8-11(14(4,5)6)12(9-10)24-15(17,18)16(19,20)25(21,22)23/h7-9H,1-6H3,(H,21,22,23) |
| InChIKey | JKCBSTFPAHAMTH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|