C18H22F8O5S — CID 169277883
2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 169277883) has the molecular formula C18H22F8O5S and a molecular weight of 502.42 g/mol. Its IUPAC name is 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 169277883 |
| Molecular Formula | C18H22F8O5S |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | CC(C)(C)c1cc(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H22F8O5S/c1-13(2,3)10-7-9(8-11(12(10)27)14(4,5)6)15(19,20)16(21,22)31-17(23,24)18(25,26)32(28,29)30/h7-8,27H,1-6H3,(H,28,29,30) |
| InChIKey | URSGUFWMKHMXOE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|