C10H7F15O6S — CID 22568757
1,1,2,2-tetrafluoro-2-[1,1,2-trifluoro-1-[1,1,2-trifluoro-1-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl]oxypropan-2-yl]oxyethanesulfonic acid (PubChem CID 22568757) has the molecular formula C10H7F15O6S and a molecular weight of 540.20 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2-trifluoro-1-[1,1,2-trifluoro-1-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl]oxypropan-2-yl]oxyethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2-trifluoro-1-[1,1,2-trifluoro-1-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl]oxypropan-2-yl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 22568757 |
| Molecular Formula | C10H7F15O6S |
| Molecular Weight | 540.20 g/mol |
| Exact Mass | 539.97 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2-trifluoro-1-[1,1,2-trifluoro-1-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl]oxypropan-2-yl]oxyethanesulfonic acid |
| SMILES | CC(F)(OC(F)(F)C(F)(F)S(=O)(=O)O)C(F)(F)OC(C)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7F15O6S/c1-3(11,30-9(22,23)10(24,25)32(26,27)28)6(16,17)29-4(2,12)7(18,19)31-8(20,21)5(13,14)15/h1-2H3,(H,26,27,28) |
| InChIKey | UFJJWSRMVSWNTH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.20 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|