C6HF13O4S — CID 101454725
1,1,2,2,3,3,4,4-octafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butane-1-sulfonic acid (PubChem CID 101454725) has the molecular formula C6HF13O4S and a molecular weight of 416.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 101454725 |
| Molecular Formula | C6HF13O4S |
| Molecular Weight | 416.11 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HF13O4S/c7-1(8,2(9,10)6(18,19)24(20,21)22)4(14,15)23-5(16,17)3(11,12)13/h(H,20,21,22) |
| InChIKey | LINGYYNETDERQG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.11 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|