C4HF9O4S — CID 139597355
1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propane-1-sulfonic acid (PubChem CID 139597355) has the molecular formula C4HF9O4S and a molecular weight of 316.10 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 139597355 |
| Molecular Formula | C4HF9O4S |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C4HF9O4S/c5-1(6,3(9,10)18(14,15)16)2(7,8)17-4(11,12)13/h(H,14,15,16) |
| InChIKey | UQSKZXLVALTWRV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|