C4F10O3S — CID 165365650
1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propane-1-sulfonyl fluoride (PubChem CID 165365650) has the molecular formula C4F10O3S and a molecular weight of 318.09 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propane-1-sulfonyl fluoride.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 165365650 |
| Molecular Formula | C4F10O3S |
| Molecular Weight | 318.09 g/mol |
| Exact Mass | 317.94 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propane-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C4F10O3S/c5-1(6,3(9,10)18(14,15)16)2(7,8)17-4(11,12)13 |
| InChIKey | DXHBQVHJLUSTNX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|