C3F7O4S- — CID 20758408
1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethanesulfonate (PubChem CID 20758408) has the molecular formula C3F7O4S- and a molecular weight of 265.08 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethanesulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 20758408 |
| Molecular Formula | C3F7O4S- |
| Molecular Weight | 265.08 g/mol |
| Exact Mass | 264.94 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C3HF7O4S/c4-1(5,14-3(8,9)10)2(6,7)15(11,12)13/h(H,11,12,13)/p-1 |
| InChIKey | KVQPTMRJUGXQHT-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.08 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|