C5F10O6S2-2 — CID 58716100
1,1,2,2,3,3,4,4,5,5-decafluoropentane-1,5-disulfonate (PubChem CID 58716100) has the molecular formula C5F10O6S2-2 and a molecular weight of 410.16 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decafluoropentane-1,5-disulfonate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decafluoropentane-1,5-disulfonate |
|---|---|
| PubChem CID | 58716100 |
| Molecular Formula | C5F10O6S2-2 |
| Molecular Weight | 410.16 g/mol |
| Exact Mass | 409.90 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decafluoropentane-1,5-disulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C5H2F10O6S2/c6-1(7,2(8,9)4(12,13)22(16,17)18)3(10,11)5(14,15)23(19,20)21/h(H,16,17,18)(H,19,20,21)/p-2 |
| InChIKey | SGSGRSWCXGZGRZ-UHFFFAOYSA-L |
| XLogP | 1.17 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|