C6F14IrO6S2-2 — CID 162115807
bis(1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate);iridium (PubChem CID 162115807) has the molecular formula C6F14IrO6S2-2 and a molecular weight of 690.38 g/mol. Its IUPAC name is bis(1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate);iridium.
| Compound Name | bis(1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate);iridium |
|---|---|
| PubChem CID | 162115807 |
| Molecular Formula | C6F14IrO6S2-2 |
| Molecular Weight | 690.38 g/mol |
| Exact Mass | 690.86 |
| IUPAC Name | bis(1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate);iridium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)F.[Ir] |
| InChI | InChI=1S/2C3HF7O3S.Ir/c2*4-1(5,2(6,7)8)3(9,10)14(11,12)13;/h2*(H,11,12,13);/p-2 |
| InChIKey | QSBHMOTUIIVHOJ-UHFFFAOYSA-L |
| XLogP | 2.64 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|