C7H12F7NO3S — CID 23287339
1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;tetramethylazanium (PubChem CID 23287339) has the molecular formula C7H12F7NO3S and a molecular weight of 323.23 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;tetramethylazanium.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;tetramethylazanium |
|---|---|
| PubChem CID | 23287339 |
| Molecular Formula | C7H12F7NO3S |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;tetramethylazanium |
| SMILES | C[N+](C)(C)C.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H12N.C3HF7O3S/c1-5(2,3)4;4-1(5,2(6,7)8)3(9,10)14(11,12)13/h1-4H3;(H,11,12,13)/q+1;/p-1 |
| InChIKey | AGFDHYKIJAGRIC-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|