C6F14HgO6S2 — CID 22604813
bis(1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate);mercury(2+) (PubChem CID 22604813) has the molecular formula C6F14HgO6S2 and a molecular weight of 698.76 g/mol. Its IUPAC name is bis(1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate);mercury(2+).
| Compound Name | bis(1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate);mercury(2+) |
|---|---|
| PubChem CID | 22604813 |
| Molecular Formula | C6F14HgO6S2 |
| Molecular Weight | 698.76 g/mol |
| Exact Mass | 699.86 |
| IUPAC Name | bis(1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate);mercury(2+) |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)F.[Hg+2] |
| InChI | InChI=1S/2C3HF7O3S.Hg/c2*4-1(5,2(6,7)8)3(9,10)14(11,12)13;/h2*(H,11,12,13);/q;;+2/p-2 |
| InChIKey | ZRNKKRODGQJJSJ-UHFFFAOYSA-L |
| XLogP | 2.64 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|