C3AgF7O3S — CID 88642392
silver 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate (PubChem CID 88642392) has the molecular formula C3AgF7O3S and a molecular weight of 356.95 g/mol. Its IUPAC name is silver 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate.
| Compound Name | silver 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 88642392 |
| Molecular Formula | C3AgF7O3S |
| Molecular Weight | 356.95 g/mol |
| Exact Mass | 355.85 |
| IUPAC Name | silver 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)F.[Ag+] |
| InChI | InChI=1S/C3HF7O3S.Ag/c4-1(5,2(6,7)8)3(9,10)14(11,12)13;/h(H,11,12,13);/q;+1/p-1 |
| InChIKey | DIBVNMQVCHOPTN-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.95 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|