C8F16O6S2-2 — CID 58716102
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane-1,8-disulfonate (PubChem CID 58716102) has the molecular formula C8F16O6S2-2 and a molecular weight of 560.18 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane-1,8-disulfonate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane-1,8-disulfonate |
|---|---|
| PubChem CID | 58716102 |
| Molecular Formula | C8F16O6S2-2 |
| Molecular Weight | 560.18 g/mol |
| Exact Mass | 559.89 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane-1,8-disulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C8H2F16O6S2/c9-1(10,3(13,14)5(17,18)7(21,22)31(25,26)27)2(11,12)4(15,16)6(19,20)8(23,24)32(28,29)30/h(H,25,26,27)(H,28,29,30)/p-2 |
| InChIKey | DAFDGVYRQAVFFW-UHFFFAOYSA-L |
| XLogP | 3.07 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|