C9ClF18O4S- — CID 162679373
2-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptoxy)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 162679373) has the molecular formula C9ClF18O4S- and a molecular weight of 581.58 g/mol. Its IUPAC name is 2-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptoxy)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 2-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptoxy)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 162679373 |
| Molecular Formula | C9ClF18O4S- |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 580.89 |
| IUPAC Name | 2-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptoxy)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C9HClF18O4S/c10-6(21,22)4(17,18)2(13,14)1(11,12)3(15,16)5(19,20)7(23,24)32-8(25,26)9(27,28)33(29,30)31/h(H,29,30,31)/p-1 |
| InChIKey | BPKLDJPVABGUPE-UHFFFAOYSA-M |
| XLogP | 5.33 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|