C8ClF17O — CID 12829603
1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-(1,1,2,2,2-pentafluoroethoxy)hexane (PubChem CID 12829603) has the molecular formula C8ClF17O and a molecular weight of 470.51 g/mol. Its IUPAC name is 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-(1,1,2,2,2-pentafluoroethoxy)hexane.
| Compound Name | 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-(1,1,2,2,2-pentafluoroethoxy)hexane |
|---|---|
| PubChem CID | 12829603 |
| Molecular Formula | C8ClF17O |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 469.94 |
| IUPAC Name | 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-(1,1,2,2,2-pentafluoroethoxy)hexane |
| SMILES | FC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C8ClF17O/c9-5(18,19)3(14,15)1(10,11)2(12,13)4(16,17)7(23,24)27-8(25,26)6(20,21)22 |
| InChIKey | GBMMGBZLVDQXPB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|