C6Cl2F12 — CID 2736851
1,6-dichloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane (PubChem CID 2736851) has the molecular formula C6Cl2F12 and a molecular weight of 370.95 g/mol. Its IUPAC name is 1,6-dichloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane.
| Compound Name | 1,6-dichloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane |
|---|---|
| PubChem CID | 2736851 |
| Molecular Formula | C6Cl2F12 |
| Molecular Weight | 370.95 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | 1,6-dichloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C6Cl2F12/c7-5(17,18)3(13,14)1(9,10)2(11,12)4(15,16)6(8,19)20 |
| InChIKey | SNCGKZWVZZPGDQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.95 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|