C9Cl5F19 — CID 22412566
1-chloro-1,1,2,2,3,3,3-heptafluoropropane;bis(1,1-dichloro-1,2,2,3,3,3-hexafluoropropane) (PubChem CID 22412566) has the molecular formula C9Cl5F19 and a molecular weight of 646.33 g/mol. Its IUPAC name is 1-chloro-1,1,2,2,3,3,3-heptafluoropropane;bis(1,1-dichloro-1,2,2,3,3,3-hexafluoropropane).
| Compound Name | 1-chloro-1,1,2,2,3,3,3-heptafluoropropane;bis(1,1-dichloro-1,2,2,3,3,3-hexafluoropropane) |
|---|---|
| PubChem CID | 22412566 |
| Molecular Formula | C9Cl5F19 |
| Molecular Weight | 646.33 g/mol |
| Exact Mass | 643.81 |
| IUPAC Name | 1-chloro-1,1,2,2,3,3,3-heptafluoropropane;bis(1,1-dichloro-1,2,2,3,3,3-hexafluoropropane) |
| SMILES | FC(F)(F)C(F)(F)C(F)(Cl)Cl.FC(F)(F)C(F)(F)C(F)(Cl)Cl.FC(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/2C3Cl2F6.C3ClF7/c2*4-2(5,8)1(6,7)3(9,10)11;4-2(7,8)1(5,6)3(9,10)11 |
| InChIKey | RMMOVMIAPABEMX-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.33 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|