C4Cl3F7 — CID 154303598
1,1,3-trichloro-1,2,2,3,4,4,4-heptafluorobutane (PubChem CID 154303598) has the molecular formula C4Cl3F7 and a molecular weight of 287.39 g/mol. Its IUPAC name is 1,1,3-trichloro-1,2,2,3,4,4,4-heptafluorobutane.
| Compound Name | 1,1,3-trichloro-1,2,2,3,4,4,4-heptafluorobutane |
|---|---|
| PubChem CID | 154303598 |
| Molecular Formula | C4Cl3F7 |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 285.90 |
| IUPAC Name | 1,1,3-trichloro-1,2,2,3,4,4,4-heptafluorobutane |
| SMILES | FC(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)Cl |
| InChI | InChI=1S/C4Cl3F7/c5-1(8,4(12,13)14)2(9,10)3(6,7)11 |
| InChIKey | LYHJARQMHHKFKB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|